C27H39NO2 — CID 126615550
(3R,5S,10S,11S,13S,17S)-11-[4-(dimethylamino)phenyl]-13-methylspiro[2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,2'-oxirane]-17-ol (PubChem CID 126615550) has the molecular formula C27H39NO2 and a molecular weight of 409.61 g/mol. Its IUPAC name is (3R,5S,10S,11S,13S,17S)-11-[4-(dimethylamino)phenyl]-13-methylspiro[2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,2'-oxirane]-17-ol.
| Compound Name | (3R,5S,10S,11S,13S,17S)-11-[4-(dimethylamino)phenyl]-13-methylspiro[2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,2'-oxirane]-17-ol |
|---|---|
| PubChem CID | 126615550 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | (3R,5S,10S,11S,13S,17S)-11-[4-(dimethylamino)phenyl]-13-methylspiro[2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,2'-oxirane]-17-ol |
| SMILES | CN(C)c1ccc(C2C[C@@]3(C)C(CC[C@@H]3O)C3CC[C@H]4C[C@]5(CC[C@@H]4C23)CO5)cc1 |
| InChI | InChI=1S/C27H39NO2/c1-26-15-22(17-4-7-19(8-5-17)28(2)3)25-20-12-13-27(16-30-27)14-18(20)6-9-21(25)23(26)10-11-24(26)29/h4-5,7-8,18,20-25,29H,6,9-16H2,1-3H3/t18-,20-,21?,22?,23?,24-,25?,26-,27+/m0/s1 |
| InChIKey | BSGOWAJKYSAVNU-ZNASGMAWSA-N |
| XLogP | 5.23 |
| TPSA | 36.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|