C32H43NO2 — CID 145342837
11-[4-(dimethylamino)phenyl]-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;ethynylcyclopropane (PubChem CID 145342837) has the molecular formula C32H43NO2 and a molecular weight of 473.70 g/mol. Its IUPAC name is 11-[4-(dimethylamino)phenyl]-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;ethynylcyclopropane.
| Compound Name | 11-[4-(dimethylamino)phenyl]-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;ethynylcyclopropane |
|---|---|
| PubChem CID | 145342837 |
| Molecular Formula | C32H43NO2 |
| Molecular Weight | 473.70 g/mol |
| Exact Mass | 473.33 |
| IUPAC Name | 11-[4-(dimethylamino)phenyl]-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;ethynylcyclopropane |
| SMILES | C#CC1CC1.CN(C)c1ccc(C2CC3(C)C(O)CCC3C3CCC4=CC(=O)CCC4(C)C23)cc1 |
| InChI | InChI=1S/C27H37NO2.C5H6/c1-26-14-13-20(29)15-18(26)7-10-21-23-11-12-24(30)27(23,2)16-22(25(21)26)17-5-8-19(9-6-17)28(3)4;1-2-5-3-4-5/h5-6,8-9,15,21-25,30H,7,10-14,16H2,1-4H3;1,5H,3-4H2 |
| InChIKey | KCHVTBXSBJAYRR-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.70 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|