C30H42O3 — CID 142045762
17-hydroxy-10,13-dimethyl-11-(4-pentoxyphenyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 142045762) has the molecular formula C30H42O3 and a molecular weight of 450.66 g/mol. Its IUPAC name is 17-hydroxy-10,13-dimethyl-11-(4-pentoxyphenyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-hydroxy-10,13-dimethyl-11-(4-pentoxyphenyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 142045762 |
| Molecular Formula | C30H42O3 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | 17-hydroxy-10,13-dimethyl-11-(4-pentoxyphenyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCCCCOc1ccc(C2CC3(C)C(O)CCC3C3CCC4=CC(=O)CCC4(C)C23)cc1 |
| InChI | InChI=1S/C30H42O3/c1-4-5-6-17-33-23-10-7-20(8-11-23)25-19-30(3)26(13-14-27(30)32)24-12-9-21-18-22(31)15-16-29(21,2)28(24)25/h7-8,10-11,18,24-28,32H,4-6,9,12-17,19H2,1-3H3 |
| InChIKey | UMCPYTIORINWTJ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|