C27H42O3 — CID 88668101
2-[(8S,9S,10R,11R,13S,14S,17R)-10,13-dimethyl-3-oxo-11-pentoxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propanal (PubChem CID 88668101) has the molecular formula C27H42O3 and a molecular weight of 414.63 g/mol. Its IUPAC name is 2-[(8S,9S,10R,11R,13S,14S,17R)-10,13-dimethyl-3-oxo-11-pentoxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propanal.
| Compound Name | 2-[(8S,9S,10R,11R,13S,14S,17R)-10,13-dimethyl-3-oxo-11-pentoxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propanal |
|---|---|
| PubChem CID | 88668101 |
| Molecular Formula | C27H42O3 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | 2-[(8S,9S,10R,11R,13S,14S,17R)-10,13-dimethyl-3-oxo-11-pentoxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propanal |
| SMILES | CCCCCO[C@@H]1C[C@]2(C)[C@@H](C(C)C=O)CC[C@H]2[C@@H]2CCC3=CC(=O)CC[C@]3(C)[C@H]21 |
| InChI | InChI=1S/C27H42O3/c1-5-6-7-14-30-24-16-27(4)22(18(2)17-28)10-11-23(27)21-9-8-19-15-20(29)12-13-26(19,3)25(21)24/h15,17-18,21-25H,5-14,16H2,1-4H3/t18?,21-,22+,23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | HEWSYLLRDWGJPT-MOLZWHDJSA-N |
| XLogP | 6.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|