C35H58O8 — CID 57090540
(8S,9S,10R,13S,14S,17S)-11-[hexoxy(hydroxy)methoxy]-17-[2-[hexoxy(hydroxy)methoxy]acetyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 57090540) has the molecular formula C35H58O8 and a molecular weight of 606.84 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-11-[hexoxy(hydroxy)methoxy]-17-[2-[hexoxy(hydroxy)methoxy]acetyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17S)-11-[hexoxy(hydroxy)methoxy]-17-[2-[hexoxy(hydroxy)methoxy]acetyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57090540 |
| Molecular Formula | C35H58O8 |
| Molecular Weight | 606.84 g/mol |
| Exact Mass | 606.41 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-11-[hexoxy(hydroxy)methoxy]-17-[2-[hexoxy(hydroxy)methoxy]acetyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCCCCCOC(O)OCC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(OC(O)OCCCCCC)C[C@]12C |
| InChI | InChI=1S/C35H58O8/c1-5-7-9-11-19-40-32(38)42-23-29(37)28-16-15-27-26-14-13-24-21-25(36)17-18-34(24,3)31(26)30(22-35(27,28)4)43-33(39)41-20-12-10-8-6-2/h21,26-28,30-33,38-39H,5-20,22-23H2,1-4H3/t26-,27-,28+,30?,31+,32?,33?,34-,35-/m0/s1 |
| InChIKey | OIUZCYNMLALUBU-ZSMRGNHISA-N |
| XLogP | 6.46 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.84 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|