C26H32O3 — CID 145342869
(8S,10R,13S)-11-(4-methoxyphenyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 145342869) has the molecular formula C26H32O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is (8S,10R,13S)-11-(4-methoxyphenyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8S,10R,13S)-11-(4-methoxyphenyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 145342869 |
| Molecular Formula | C26H32O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (8S,10R,13S)-11-(4-methoxyphenyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | COc1ccc(C2C[C@]3(C)C(=O)CCC3[C@@H]3CCC4=CC(=O)CC[C@]4(C)C23)cc1 |
| InChI | InChI=1S/C26H32O3/c1-25-13-12-18(27)14-17(25)6-9-20-22-10-11-23(28)26(22,2)15-21(24(20)25)16-4-7-19(29-3)8-5-16/h4-5,7-8,14,20-22,24H,6,9-13,15H2,1-3H3/t20-,21?,22?,24?,25-,26-/m0/s1 |
| InChIKey | YBZMDJWJNNLGQZ-NGOWTIROSA-N |
| XLogP | 5.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |