C27H33NO2 — CID 67788008
(1S,11S,15R,16S)-5-(dimethylamino)-11-methylhexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraene-12,21-dione (PubChem CID 67788008) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is (1S,11S,15R,16S)-5-(dimethylamino)-11-methylhexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraene-12,21-dione.
| Compound Name | (1S,11S,15R,16S)-5-(dimethylamino)-11-methylhexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraene-12,21-dione |
|---|---|
| PubChem CID | 67788008 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (1S,11S,15R,16S)-5-(dimethylamino)-11-methylhexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraene-12,21-dione |
| SMILES | CN(C)c1ccc2c(c1)C[C@]13CCC(=O)C=C1CCC1C3C2C[C@]2(C)C(=O)CC[C@H]12 |
| InChI | InChI=1S/C27H33NO2/c1-26-15-22-20-7-5-18(28(2)3)12-16(20)14-27-11-10-19(29)13-17(27)4-6-21(25(22)27)23(26)8-9-24(26)30/h5,7,12-13,21-23,25H,4,6,8-11,14-15H2,1-3H3/t21?,22?,23-,25?,26+,27-/m1/s1 |
| InChIKey | KOIBEIHRAWIIKL-NVHGYDPISA-N |
| XLogP | 5.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|