C29H39NO3 — CID 67783915
(1S,9S,11S,12S,15S,16S,24R)-5-(dimethylamino)-12-hydroxy-12-(methoxymethyl)-11-methylhexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraen-21-one (PubChem CID 67783915) has the molecular formula C29H39NO3 and a molecular weight of 449.64 g/mol. Its IUPAC name is (1S,9S,11S,12S,15S,16S,24R)-5-(dimethylamino)-12-hydroxy-12-(methoxymethyl)-11-methylhexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraen-21-one.
| Compound Name | (1S,9S,11S,12S,15S,16S,24R)-5-(dimethylamino)-12-hydroxy-12-(methoxymethyl)-11-methylhexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraen-21-one |
|---|---|
| PubChem CID | 67783915 |
| Molecular Formula | C29H39NO3 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | (1S,9S,11S,12S,15S,16S,24R)-5-(dimethylamino)-12-hydroxy-12-(methoxymethyl)-11-methylhexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraen-21-one |
| SMILES | COC[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@]45Cc4cc(N(C)C)ccc4[C@@H](C[C@@]21C)[C@@H]35 |
| InChI | InChI=1S/C29H39NO3/c1-27-16-24-22-8-6-20(30(2)3)13-18(22)15-28-11-9-21(31)14-19(28)5-7-23(26(24)28)25(27)10-12-29(27,32)17-33-4/h6,8,13-14,23-26,32H,5,7,9-12,15-17H2,1-4H3/t23-,24+,25-,26+,27-,28+,29+/m0/s1 |
| InChIKey | XYLJXYNIKCPCFC-QLTIQSNDSA-N |
| XLogP | 4.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|