C30H41NO3 — CID 67783856
(1S,9S,11S,12R,15S,16S,24R)-5-(dimethylamino)-12-hydroxy-12-(3-hydroxypropyl)-11-methylhexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraen-21-one (PubChem CID 67783856) has the molecular formula C30H41NO3 and a molecular weight of 463.66 g/mol. Its IUPAC name is (1S,9S,11S,12R,15S,16S,24R)-5-(dimethylamino)-12-hydroxy-12-(3-hydroxypropyl)-11-methylhexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraen-21-one.
| Compound Name | (1S,9S,11S,12R,15S,16S,24R)-5-(dimethylamino)-12-hydroxy-12-(3-hydroxypropyl)-11-methylhexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraen-21-one |
|---|---|
| PubChem CID | 67783856 |
| Molecular Formula | C30H41NO3 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | (1S,9S,11S,12R,15S,16S,24R)-5-(dimethylamino)-12-hydroxy-12-(3-hydroxypropyl)-11-methylhexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraen-21-one |
| SMILES | CN(C)c1ccc2c(c1)C[C@]13CCC(=O)C=C1CC[C@@H]1[C@@H]3[C@@H]2C[C@@]2(C)[C@H]1CC[C@@]2(O)CCCO |
| InChI | InChI=1S/C30H41NO3/c1-28-18-25-23-8-6-21(31(2)3)15-19(23)17-29-12-9-22(33)16-20(29)5-7-24(27(25)29)26(28)10-13-30(28,34)11-4-14-32/h6,8,15-16,24-27,32,34H,4-5,7,9-14,17-18H2,1-3H3/t24-,25+,26-,27+,28-,29+,30-/m0/s1 |
| InChIKey | XRGDNYWAPGOXAL-AHRBKPOASA-N |
| XLogP | 5.02 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|