C29H35NO2S — CID 67901625
(1S,9S,11S,12S,15S,16S)-5-(dimethylamino)-12-hydroxy-11-methyl-12-prop-1-ynyl-2-thiahexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraen-21-one (PubChem CID 67901625) has the molecular formula C29H35NO2S and a molecular weight of 461.67 g/mol. Its IUPAC name is (1S,9S,11S,12S,15S,16S)-5-(dimethylamino)-12-hydroxy-11-methyl-12-prop-1-ynyl-2-thiahexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraen-21-one.
| Compound Name | (1S,9S,11S,12S,15S,16S)-5-(dimethylamino)-12-hydroxy-11-methyl-12-prop-1-ynyl-2-thiahexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraen-21-one |
|---|---|
| PubChem CID | 67901625 |
| Molecular Formula | C29H35NO2S |
| Molecular Weight | 461.67 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | (1S,9S,11S,12S,15S,16S)-5-(dimethylamino)-12-hydroxy-11-methyl-12-prop-1-ynyl-2-thiahexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraen-21-one |
| SMILES | CC#C[C@]1(O)CC[C@H]2C3CCC4=CC(=O)CC[C@@]45Sc4cc(N(C)C)ccc4[C@@H](C[C@@]21C)C35 |
| InChI | InChI=1S/C29H35NO2S/c1-5-12-28(32)13-11-24-22-8-6-18-15-20(31)10-14-29(18)26(22)23(17-27(24,28)2)21-9-7-19(30(3)4)16-25(21)33-29/h7,9,15-16,22-24,26,32H,6,8,10-11,13-14,17H2,1-4H3/t22?,23-,24+,26?,27+,28+,29-/m1/s1 |
| InChIKey | VWYMRMBMWNPWOO-LELOPBEBSA-N |
| XLogP | 5.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|