C29H35NO2 — CID 25229533
(8S,11S,13S,14S,17S)-11-[4-(dimethylamino)phenyl]-13-methyl-17-prop-1-ynyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 25229533) has the molecular formula C29H35NO2 and a molecular weight of 429.60 g/mol. Its IUPAC name is (8S,11S,13S,14S,17S)-11-[4-(dimethylamino)phenyl]-13-methyl-17-prop-1-ynyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,11S,13S,14S,17S)-11-[4-(dimethylamino)phenyl]-13-methyl-17-prop-1-ynyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 25229533 |
| Molecular Formula | C29H35NO2 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | (8S,11S,13S,14S,17S)-11-[4-(dimethylamino)phenyl]-13-methyl-17-prop-1-ynyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(O)ccc4C3[C@@H](c3ccc(N(C)C)cc3)C[C@@]21C |
| InChI | InChI=1S/C29H35NO2/c1-5-15-29(32)16-14-26-24-12-8-20-17-22(31)11-13-23(20)27(24)25(18-28(26,29)2)19-6-9-21(10-7-19)30(3)4/h6-7,9-11,13,17,24-27,31-32H,8,12,14,16,18H2,1-4H3/t24-,25+,26-,27?,28-,29-/m0/s1 |
| InChIKey | MUTAPPXGJPOOIW-YWERFTNQSA-N |
| XLogP | 5.46 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|