C31H39NO2S — CID 67902018
(1S,9S,11S,12S,15S,16S)-5-(diethylamino)-12-hydroxy-11-methyl-12-prop-1-ynyl-2-thiahexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraen-21-one (PubChem CID 67902018) has the molecular formula C31H39NO2S and a molecular weight of 489.73 g/mol. Its IUPAC name is (1S,9S,11S,12S,15S,16S)-5-(diethylamino)-12-hydroxy-11-methyl-12-prop-1-ynyl-2-thiahexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraen-21-one.
| Compound Name | (1S,9S,11S,12S,15S,16S)-5-(diethylamino)-12-hydroxy-11-methyl-12-prop-1-ynyl-2-thiahexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraen-21-one |
|---|---|
| PubChem CID | 67902018 |
| Molecular Formula | C31H39NO2S |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | (1S,9S,11S,12S,15S,16S)-5-(diethylamino)-12-hydroxy-11-methyl-12-prop-1-ynyl-2-thiahexacyclo[14.7.1.01,19.03,8.09,24.011,15]tetracosa-3(8),4,6,19-tetraen-21-one |
| SMILES | CC#C[C@]1(O)CC[C@H]2C3CCC4=CC(=O)CC[C@@]45Sc4cc(N(CC)CC)ccc4[C@@H](C[C@@]21C)C35 |
| InChI | InChI=1S/C31H39NO2S/c1-5-14-30(34)15-13-26-24-10-8-20-17-22(33)12-16-31(20)28(24)25(19-29(26,30)4)23-11-9-21(18-27(23)35-31)32(6-2)7-3/h9,11,17-18,24-26,28,34H,6-8,10,12-13,15-16,19H2,1-4H3/t24?,25-,26+,28?,29+,30+,31-/m1/s1 |
| InChIKey | QAMURLLCLICFSI-XVGPZDGHSA-N |
| XLogP | 6.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|