C27H35BrO4 — CID 174962537
1-bromo-2,4-dimethoxybenzene;(8R,9S,10R,13S,14S)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 174962537) has the molecular formula C27H35BrO4 and a molecular weight of 503.48 g/mol. Its IUPAC name is 1-bromo-2,4-dimethoxybenzene;(8R,9S,10R,13S,14S)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | 1-bromo-2,4-dimethoxybenzene;(8R,9S,10R,13S,14S)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 174962537 |
| Molecular Formula | C27H35BrO4 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 1-bromo-2,4-dimethoxybenzene;(8R,9S,10R,13S,14S)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | COc1ccc(Br)c(OC)c1.C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C19H26O2.C8H9BrO2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18;1-10-6-3-4-7(9)8(5-6)11-2/h11,14-16H,3-10H2,1-2H3;3-5H,1-2H3/t14-,15-,16-,18-,19-;/m0./s1 |
| InChIKey | RPZXMZXXSNFMHW-HGBARDOKSA-N |
| XLogP | 6.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |