C31H46O5Si — CID 174906362
(8R,9S,10R,13S,14S)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione;triethoxy(phenyl)silane (PubChem CID 174906362) has the molecular formula C31H46O5Si and a molecular weight of 526.79 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione;triethoxy(phenyl)silane.
| Compound Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione;triethoxy(phenyl)silane |
|---|---|
| PubChem CID | 174906362 |
| Molecular Formula | C31H46O5Si |
| Molecular Weight | 526.79 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione;triethoxy(phenyl)silane |
| SMILES | CCO[Si](OCC)(OCC)c1ccccc1.C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C19H26O2.C12H20O3Si/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18;1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12/h11,14-16H,3-10H2,1-2H3;7-11H,4-6H2,1-3H3/t14-,15-,16-,18-,19-;/m0./s1 |
| InChIKey | DELFKRNNGPLRQD-HGBARDOKSA-N |
| XLogP | 6.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.79 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|