C28H34O3 — CID 18600039
(8R,9S,10R,13S,14S)-10,13-dimethyl-17-(2-phenylmethoxyacetyl)-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 18600039) has the molecular formula C28H34O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10,13-dimethyl-17-(2-phenylmethoxyacetyl)-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-17-(2-phenylmethoxyacetyl)-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 18600039 |
| Molecular Formula | C28H34O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-17-(2-phenylmethoxyacetyl)-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(C(=O)COCc3ccccc3)=CC[C@@H]12 |
| InChI | InChI=1S/C28H34O3/c1-27-14-12-21(29)16-20(27)8-9-22-23-10-11-25(28(23,2)15-13-24(22)27)26(30)18-31-17-19-6-4-3-5-7-19/h3-7,11,16,22-24H,8-10,12-15,17-18H2,1-2H3/t22-,23-,24-,27-,28-/m0/s1 |
| InChIKey | OYMYBEGJXCKQPH-NKILSJRUSA-N |
| XLogP | 5.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |