C23H31ClO3 — CID 154155900
[2-chloro-2-[(8R,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]ethyl] acetate (PubChem CID 154155900) has the molecular formula C23H31ClO3 and a molecular weight of 390.95 g/mol. Its IUPAC name is [2-chloro-2-[(8R,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]ethyl] acetate.
| Compound Name | [2-chloro-2-[(8R,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]ethyl] acetate |
|---|---|
| PubChem CID | 154155900 |
| Molecular Formula | C23H31ClO3 |
| Molecular Weight | 390.95 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | [2-chloro-2-[(8R,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]ethyl] acetate |
| SMILES | CC(=O)OCC(Cl)C1=CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H31ClO3/c1-14(25)27-13-21(24)20-7-6-18-17-5-4-15-12-16(26)8-10-22(15,2)19(17)9-11-23(18,20)3/h7,12,17-19,21H,4-6,8-11,13H2,1-3H3/t17-,18-,19-,21?,22-,23-/m0/s1 |
| InChIKey | SGETXHDECYGJPQ-BIPPRZMMSA-N |
| XLogP | 5.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.95 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|