C27H38O5 — CID 165021737
dimethyl 2-[(2R)-2-[(10R,13S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]propyl]propanedioate (PubChem CID 165021737) has the molecular formula C27H38O5 and a molecular weight of 442.60 g/mol. Its IUPAC name is dimethyl 2-[(2R)-2-[(10R,13S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]propyl]propanedioate.
| Compound Name | dimethyl 2-[(2R)-2-[(10R,13S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]propyl]propanedioate |
|---|---|
| PubChem CID | 165021737 |
| Molecular Formula | C27H38O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | dimethyl 2-[(2R)-2-[(10R,13S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]propyl]propanedioate |
| SMILES | COC(=O)C(C[C@@H](C)C1=CCC2C3CCC4=CC(=O)CC[C@]4(C)C3CC[C@]12C)C(=O)OC |
| InChI | InChI=1S/C27H38O5/c1-16(14-20(24(29)31-4)25(30)32-5)21-8-9-22-19-7-6-17-15-18(28)10-12-26(17,2)23(19)11-13-27(21,22)3/h8,15-16,19-20,22-23H,6-7,9-14H2,1-5H3/t16-,19?,22?,23?,26+,27-/m1/s1 |
| InChIKey | LGLZYZAPDRTXHX-UNHWHLNKSA-N |
| XLogP | 5.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|