C21H29ClO3 — CID 11595727
(4aR,4bS,6aS,7S,10aS,10bR)-8-chloro-7-hydroxy-7-(hydroxymethyl)-4a,6a-dimethyl-3,4,4b,5,6,10,10a,10b,11,12-decahydrochrysen-2-one (PubChem CID 11595727) has the molecular formula C21H29ClO3 and a molecular weight of 364.91 g/mol. Its IUPAC name is (4aR,4bS,6aS,7S,10aS,10bR)-8-chloro-7-hydroxy-7-(hydroxymethyl)-4a,6a-dimethyl-3,4,4b,5,6,10,10a,10b,11,12-decahydrochrysen-2-one.
| Compound Name | (4aR,4bS,6aS,7S,10aS,10bR)-8-chloro-7-hydroxy-7-(hydroxymethyl)-4a,6a-dimethyl-3,4,4b,5,6,10,10a,10b,11,12-decahydrochrysen-2-one |
|---|---|
| PubChem CID | 11595727 |
| Molecular Formula | C21H29ClO3 |
| Molecular Weight | 364.91 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (4aR,4bS,6aS,7S,10aS,10bR)-8-chloro-7-hydroxy-7-(hydroxymethyl)-4a,6a-dimethyl-3,4,4b,5,6,10,10a,10b,11,12-decahydrochrysen-2-one |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC=C(Cl)[C@@]2(O)CO |
| InChI | InChI=1S/C21H29ClO3/c1-19-9-7-14(24)11-13(19)3-4-15-16(19)8-10-20(2)17(15)5-6-18(22)21(20,25)12-23/h6,11,15-17,23,25H,3-5,7-10,12H2,1-2H3/t15-,16+,17+,19+,20+,21+/m1/s1 |
| InChIKey | NKCYWULWZSTAQP-OBQKJFGGSA-N |
| XLogP | 3.97 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.91 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |