C22H30Cl2O2 — CID 11682704
(4aR,4bS,6aS,7S,10aS,10bR,11R)-8-chloro-7-(chloromethyl)-7-hydroxy-4a,6a,11-trimethyl-3,4,4b,5,6,10,10a,10b,11,12-decahydrochrysen-2-one (PubChem CID 11682704) has the molecular formula C22H30Cl2O2 and a molecular weight of 397.39 g/mol. Its IUPAC name is (4aR,4bS,6aS,7S,10aS,10bR,11R)-8-chloro-7-(chloromethyl)-7-hydroxy-4a,6a,11-trimethyl-3,4,4b,5,6,10,10a,10b,11,12-decahydrochrysen-2-one.
| Compound Name | (4aR,4bS,6aS,7S,10aS,10bR,11R)-8-chloro-7-(chloromethyl)-7-hydroxy-4a,6a,11-trimethyl-3,4,4b,5,6,10,10a,10b,11,12-decahydrochrysen-2-one |
|---|---|
| PubChem CID | 11682704 |
| Molecular Formula | C22H30Cl2O2 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (4aR,4bS,6aS,7S,10aS,10bR,11R)-8-chloro-7-(chloromethyl)-7-hydroxy-4a,6a,11-trimethyl-3,4,4b,5,6,10,10a,10b,11,12-decahydrochrysen-2-one |
| SMILES | C[C@@H]1CC2=CC(=O)CC[C@]2(C)[C@H]2CC[C@@]3(C)[C@@H](CC=C(Cl)[C@@]3(O)CCl)[C@H]12 |
| InChI | InChI=1S/C22H30Cl2O2/c1-13-10-14-11-15(25)6-8-20(14,2)16-7-9-21(3)17(19(13)16)4-5-18(24)22(21,26)12-23/h5,11,13,16-17,19,26H,4,6-10,12H2,1-3H3/t13-,16+,17+,19-,20+,21+,22+/m1/s1 |
| InChIKey | OMKGLAMFUGAPTH-GFDYAFGLSA-N |
| XLogP | 5.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|