C25H37ClO4 — CID 70517961
3-[(7R,8R,9S,10R,13S,14S,17R)-7-(3-chloropropyl)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid (PubChem CID 70517961) has the molecular formula C25H37ClO4 and a molecular weight of 437.02 g/mol. Its IUPAC name is 3-[(7R,8R,9S,10R,13S,14S,17R)-7-(3-chloropropyl)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid.
| Compound Name | 3-[(7R,8R,9S,10R,13S,14S,17R)-7-(3-chloropropyl)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid |
|---|---|
| PubChem CID | 70517961 |
| Molecular Formula | C25H37ClO4 |
| Molecular Weight | 437.02 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 3-[(7R,8R,9S,10R,13S,14S,17R)-7-(3-chloropropyl)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid |
| SMILES | C[C@]12CCC(=O)C=C1C[C@@H](CCCCl)[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)CCC(=O)O |
| InChI | InChI=1S/C25H37ClO4/c1-23-9-5-18(27)15-17(23)14-16(4-3-13-26)22-19(23)6-10-24(2)20(22)7-11-25(24,30)12-8-21(28)29/h15-16,19-20,22,30H,3-14H2,1-2H3,(H,28,29)/t16-,19+,20+,22-,23+,24+,25-/m1/s1 |
| InChIKey | ZAACULQNKAMCNT-JEHIOXJOSA-N |
| XLogP | 5.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.02 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|