C24H36O4S — CID 88810149
(8R,9R,10R,13S,14S)-17-hydroxy-17-(3-hydroxypropyl)-10,13-dimethyl-7-(2-sulfanylacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 88810149) has the molecular formula C24H36O4S and a molecular weight of 420.62 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-17-hydroxy-17-(3-hydroxypropyl)-10,13-dimethyl-7-(2-sulfanylacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10R,13S,14S)-17-hydroxy-17-(3-hydroxypropyl)-10,13-dimethyl-7-(2-sulfanylacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88810149 |
| Molecular Formula | C24H36O4S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (8R,9R,10R,13S,14S)-17-hydroxy-17-(3-hydroxypropyl)-10,13-dimethyl-7-(2-sulfanylacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1CC(C(=O)CS)[C@@H]1[C@H]2CC[C@@]2(C)[C@H]1CCC2(O)CCCO |
| InChI | InChI=1S/C24H36O4S/c1-22-8-4-16(26)12-15(22)13-17(20(27)14-29)21-18(22)5-9-23(2)19(21)6-10-24(23,28)7-3-11-25/h12,17-19,21,25,28-29H,3-11,13-14H2,1-2H3/t17?,18-,19+,21-,22+,23+,24?/m1/s1 |
| InChIKey | PJNCTBTYRZSFSW-MZRQJQHESA-N |
| XLogP | 3.75 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|