C28H45NO2 — CID 57141309
9-[(7R,8S,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl]nonanamide (PubChem CID 57141309) has the molecular formula C28H45NO2 and a molecular weight of 427.67 g/mol. Its IUPAC name is 9-[(7R,8S,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl]nonanamide.
| Compound Name | 9-[(7R,8S,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl]nonanamide |
|---|---|
| PubChem CID | 57141309 |
| Molecular Formula | C28H45NO2 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 427.35 |
| IUPAC Name | 9-[(7R,8S,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl]nonanamide |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1[C@H](CCCCCCCCC(N)=O)CC3=CC(=O)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C28H45NO2/c1-27-15-9-11-23(27)26-20(10-7-5-3-4-6-8-12-25(29)31)18-21-19-22(30)13-17-28(21,2)24(26)14-16-27/h19-20,23-24,26H,3-18H2,1-2H3,(H2,29,31)/t20-,23+,24+,26+,27+,28+/m1/s1 |
| InChIKey | BNDSKQHOWBKQPH-UELGWYSCSA-N |
| XLogP | 6.74 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|