C20H28O — CID 57082413
(1S,10R,11S,14S,18S)-10,14-dimethylpentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-7-one (PubChem CID 57082413) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (1S,10R,11S,14S,18S)-10,14-dimethylpentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-7-one.
| Compound Name | (1S,10R,11S,14S,18S)-10,14-dimethylpentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-7-one |
|---|---|
| PubChem CID | 57082413 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (1S,10R,11S,14S,18S)-10,14-dimethylpentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-7-one |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1C3CC3C3=CC(=O)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C20H28O/c1-19-7-3-4-15(19)18-14-11-13(14)17-10-12(21)5-9-20(17,2)16(18)6-8-19/h10,13-16,18H,3-9,11H2,1-2H3/t13?,14?,15-,16-,18-,19-,20+/m0/s1 |
| InChIKey | VGRGJBKURZINNW-QQHHGQSBSA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |