C23H30O3 — CID 50909327
(4'R,5R,10'R,14'S)-10',14'-dimethylspiro[oxolane-5,15'-pentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene]-2,7'-dione (PubChem CID 50909327) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is (4'R,5R,10'R,14'S)-10',14'-dimethylspiro[oxolane-5,15'-pentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene]-2,7'-dione.
| Compound Name | (4'R,5R,10'R,14'S)-10',14'-dimethylspiro[oxolane-5,15'-pentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene]-2,7'-dione |
|---|---|
| PubChem CID | 50909327 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (4'R,5R,10'R,14'S)-10',14'-dimethylspiro[oxolane-5,15'-pentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene]-2,7'-dione |
| SMILES | C[C@]12CCC(=O)C=C1[C@@H]1CC1C1C2CC[C@@]2(C)C1CC[C@@]21CCC(=O)O1 |
| InChI | InChI=1S/C23H30O3/c1-21-7-3-13(24)11-18(21)14-12-15(14)20-16(21)4-8-22(2)17(20)5-9-23(22)10-6-19(25)26-23/h11,14-17,20H,3-10,12H2,1-2H3/t14-,15?,16?,17?,20?,21-,22+,23-/m1/s1 |
| InChIKey | RRHHMFQGHCFGMH-RTYUFGGNSA-N |
| XLogP | 4.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |