C19H25NO2 — CID 67742464
(1R,2S,4S,10R,11S,14S,18S)-10,14-dimethyl-16-azapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene-7,15-dione (PubChem CID 67742464) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (1R,2S,4S,10R,11S,14S,18S)-10,14-dimethyl-16-azapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene-7,15-dione.
| Compound Name | (1R,2S,4S,10R,11S,14S,18S)-10,14-dimethyl-16-azapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene-7,15-dione |
|---|---|
| PubChem CID | 67742464 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (1R,2S,4S,10R,11S,14S,18S)-10,14-dimethyl-16-azapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene-7,15-dione |
| SMILES | C[C@]12CCC(=O)C=C1[C@H]1C[C@H]1[C@@H]1[C@@H]2CC[C@]2(C)C(=O)NC[C@@H]12 |
| InChI | InChI=1S/C19H25NO2/c1-18-5-3-10(21)7-14(18)11-8-12(11)16-13(18)4-6-19(2)15(16)9-20-17(19)22/h7,11-13,15-16H,3-6,8-9H2,1-2H3,(H,20,22)/t11-,12+,13-,15-,16+,18+,19-/m0/s1 |
| InChIKey | REIMEWBJHDXFHJ-VVWWNRJZSA-N |
| XLogP | 2.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |