C27H33NO — CID 90753310
16-ethenyl-10,14-dimethyl-7-oxo-15-prop-2-enylhexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-ene-15-carbonitrile (PubChem CID 90753310) has the molecular formula C27H33NO and a molecular weight of 387.57 g/mol. Its IUPAC name is 16-ethenyl-10,14-dimethyl-7-oxo-15-prop-2-enylhexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-ene-15-carbonitrile.
| Compound Name | 16-ethenyl-10,14-dimethyl-7-oxo-15-prop-2-enylhexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-ene-15-carbonitrile |
|---|---|
| PubChem CID | 90753310 |
| Molecular Formula | C27H33NO |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 16-ethenyl-10,14-dimethyl-7-oxo-15-prop-2-enylhexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-ene-15-carbonitrile |
| SMILES | C=CCC1(C#N)C2(C)CCC3C(C4CC4C4=CC(=O)CCC43C)C2C2CC21C=C |
| InChI | InChI=1S/C27H33NO/c1-5-9-27(15-28)25(4)11-8-19-22(23(25)21-14-26(21,27)6-2)18-13-17(18)20-12-16(29)7-10-24(19,20)3/h5-6,12,17-19,21-23H,1-2,7-11,13-14H2,3-4H3 |
| InChIKey | AYVDDONPNSSTGH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|