C25H30O4 — CID 88936457
ethyl 3-[(3R,5S,6S,8R,12R,18R,20R)-12-methyl-15-oxo-7-oxaheptacyclo[9.9.0.02,8.03,5.06,8.012,17.018,20]icos-16-en-6-yl]prop-2-enoate (PubChem CID 88936457) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is ethyl 3-[(3R,5S,6S,8R,12R,18R,20R)-12-methyl-15-oxo-7-oxaheptacyclo[9.9.0.02,8.03,5.06,8.012,17.018,20]icos-16-en-6-yl]prop-2-enoate.
| Compound Name | ethyl 3-[(3R,5S,6S,8R,12R,18R,20R)-12-methyl-15-oxo-7-oxaheptacyclo[9.9.0.02,8.03,5.06,8.012,17.018,20]icos-16-en-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 88936457 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | ethyl 3-[(3R,5S,6S,8R,12R,18R,20R)-12-methyl-15-oxo-7-oxaheptacyclo[9.9.0.02,8.03,5.06,8.012,17.018,20]icos-16-en-6-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=C[C@@]12O[C@@]13CCC1C(C3C3C[C@@H]32)[C@H]2C[C@H]2C2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C25H30O4/c1-3-28-20(27)6-9-24-19-12-16(19)22-21-15-11-14(15)18-10-13(26)4-7-23(18,2)17(21)5-8-25(22,24)29-24/h6,9-10,14-17,19,21-22H,3-5,7-8,11-12H2,1-2H3/t14-,15+,16?,17?,19+,21?,22?,23-,24+,25-/m1/s1 |
| InChIKey | MZZGNOYKOFKUCX-HJEMLOSYSA-N |
| XLogP | 3.85 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|