C27H40O4 — CID 145403417
ethyl (E,4R)-4-[(6R,7R,10R,13R,17R)-7-hydroxy-6,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pent-2-enoate (PubChem CID 145403417) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is ethyl (E,4R)-4-[(6R,7R,10R,13R,17R)-7-hydroxy-6,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pent-2-enoate.
| Compound Name | ethyl (E,4R)-4-[(6R,7R,10R,13R,17R)-7-hydroxy-6,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pent-2-enoate |
|---|---|
| PubChem CID | 145403417 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | ethyl (E,4R)-4-[(6R,7R,10R,13R,17R)-7-hydroxy-6,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](C)[C@H]1CCC2C3C(O)[C@H](C)C4=CC(=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H40O4/c1-6-31-23(29)10-7-16(2)19-8-9-20-24-21(12-14-26(19,20)4)27(5)13-11-18(28)15-22(27)17(3)25(24)30/h7,10,15-17,19-21,24-25,30H,6,8-9,11-14H2,1-5H3/b10-7+/t16-,17-,19-,20?,21?,24?,25?,26-,27-/m1/s1 |
| InChIKey | BOWUDCUBOGMVPJ-TWEXRLAUSA-N |
| XLogP | 5.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|