C26H38O4 — CID 121358220
ethyl (4R)-4-[(2S,4R,10R,14R,15R)-10,14-dimethyl-7-oxo-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-15-yl]pentanoate (PubChem CID 121358220) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is ethyl (4R)-4-[(2S,4R,10R,14R,15R)-10,14-dimethyl-7-oxo-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-15-yl]pentanoate.
| Compound Name | ethyl (4R)-4-[(2S,4R,10R,14R,15R)-10,14-dimethyl-7-oxo-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-15-yl]pentanoate |
|---|---|
| PubChem CID | 121358220 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | ethyl (4R)-4-[(2S,4R,10R,14R,15R)-10,14-dimethyl-7-oxo-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-15-yl]pentanoate |
| SMILES | CCOC(=O)CC[C@@H](C)[C@H]1CCC2C3C(CC[C@@]21C)[C@@]1(C)CCC(=O)C=C1[C@H]1O[C@@H]31 |
| InChI | InChI=1S/C26H38O4/c1-5-29-21(28)9-6-15(2)17-7-8-18-22-19(11-13-25(17,18)3)26(4)12-10-16(27)14-20(26)23-24(22)30-23/h14-15,17-19,22-24H,5-13H2,1-4H3/t15-,17-,18?,19?,22?,23-,24+,25-,26-/m1/s1 |
| InChIKey | QQDJQGSAPWYYOA-RUGHZKRWSA-N |
| XLogP | 5.10 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|