C24H36O2 — CID 147067643
(2R,4S,10R,14R,15R)-10,14-dimethyl-15-[(2R)-pentan-2-yl]-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-7-one (PubChem CID 147067643) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is (2R,4S,10R,14R,15R)-10,14-dimethyl-15-[(2R)-pentan-2-yl]-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-7-one.
| Compound Name | (2R,4S,10R,14R,15R)-10,14-dimethyl-15-[(2R)-pentan-2-yl]-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-7-one |
|---|---|
| PubChem CID | 147067643 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | (2R,4S,10R,14R,15R)-10,14-dimethyl-15-[(2R)-pentan-2-yl]-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-7-one |
| SMILES | CCC[C@@H](C)[C@H]1CCC2C3C(CC[C@@]21C)[C@@]1(C)CCC(=O)C=C1[C@@H]1O[C@H]31 |
| InChI | InChI=1S/C24H36O2/c1-5-6-14(2)16-7-8-17-20-18(10-12-23(16,17)3)24(4)11-9-15(25)13-19(24)21-22(20)26-21/h13-14,16-18,20-22H,5-12H2,1-4H3/t14-,16-,17?,18?,20?,21+,22-,23-,24-/m1/s1 |
| InChIKey | BEKSECQCHJONAM-QOVNIZNCSA-N |
| XLogP | 5.56 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|