C31H48O2 — CID 143166242
(1S,15S)-18-[4-(3,3-dimethyloxiran-2-yl)butan-2-yl]-2,19-dimethylpentacyclo[12.7.0.02,7.08,13.015,19]henicos-6-en-5-one (PubChem CID 143166242) has the molecular formula C31H48O2 and a molecular weight of 452.72 g/mol. Its IUPAC name is (1S,15S)-18-[4-(3,3-dimethyloxiran-2-yl)butan-2-yl]-2,19-dimethylpentacyclo[12.7.0.02,7.08,13.015,19]henicos-6-en-5-one.
| Compound Name | (1S,15S)-18-[4-(3,3-dimethyloxiran-2-yl)butan-2-yl]-2,19-dimethylpentacyclo[12.7.0.02,7.08,13.015,19]henicos-6-en-5-one |
|---|---|
| PubChem CID | 143166242 |
| Molecular Formula | C31H48O2 |
| Molecular Weight | 452.72 g/mol |
| Exact Mass | 452.37 |
| IUPAC Name | (1S,15S)-18-[4-(3,3-dimethyloxiran-2-yl)butan-2-yl]-2,19-dimethylpentacyclo[12.7.0.02,7.08,13.015,19]henicos-6-en-5-one |
| SMILES | CC(CCC1OC1(C)C)C1CC[C@H]2C3C4CCCCC4C4=CC(=O)CCC4(C)[C@H]3CCC12C |
| InChI | InChI=1S/C31H48O2/c1-19(10-13-27-29(2,3)33-27)23-11-12-24-28-22-9-7-6-8-21(22)26-18-20(32)14-16-31(26,5)25(28)15-17-30(23,24)4/h18-19,21-25,27-28H,6-17H2,1-5H3/t19?,21?,22?,23?,24-,25-,27?,28?,30?,31?/m0/s1 |
| InChIKey | ZBGUKLQZGRRNCK-YDDBYFHVSA-N |
| XLogP | 7.75 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.72 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|