C28H39NO4S — CID 139498213
(E,4R)-N-cyclopropylsulfonyl-4-[(2S,4S,10R,14R)-10,14-dimethyl-7-oxo-15-pentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-enyl]pent-2-enamide (PubChem CID 139498213) has the molecular formula C28H39NO4S and a molecular weight of 485.69 g/mol. Its IUPAC name is (E,4R)-N-cyclopropylsulfonyl-4-[(2S,4S,10R,14R)-10,14-dimethyl-7-oxo-15-pentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-enyl]pent-2-enamide.
| Compound Name | (E,4R)-N-cyclopropylsulfonyl-4-[(2S,4S,10R,14R)-10,14-dimethyl-7-oxo-15-pentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-enyl]pent-2-enamide |
|---|---|
| PubChem CID | 139498213 |
| Molecular Formula | C28H39NO4S |
| Molecular Weight | 485.69 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | (E,4R)-N-cyclopropylsulfonyl-4-[(2S,4S,10R,14R)-10,14-dimethyl-7-oxo-15-pentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-enyl]pent-2-enamide |
| SMILES | C[C@H](/C=C/C(=O)NS(=O)(=O)C1CC1)C1CCC2C3C(CC[C@@]21C)[C@@]1(C)CCC(=O)C=C1[C@H]1C[C@@H]31 |
| InChI | InChI=1S/C28H39NO4S/c1-16(4-9-25(31)29-34(32,33)18-5-6-18)21-7-8-22-26-20-15-19(20)24-14-17(30)10-12-28(24,3)23(26)11-13-27(21,22)2/h4,9,14,16,18-23,26H,5-8,10-13,15H2,1-3H3,(H,29,31)/b9-4+/t16-,19+,20-,21?,22?,23?,26?,27-,28-/m1/s1 |
| InChIKey | RVTMYNCHTKQEEZ-LRKMYMAHSA-N |
| XLogP | 4.79 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.69 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|