C34H54O3 — CID 159876220
hex-1-ene;(7S,8R,9S,10R,13S,14S,17R)-7-hexyl-10,13-dimethylspiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione (PubChem CID 159876220) has the molecular formula C34H54O3 and a molecular weight of 510.80 g/mol. Its IUPAC name is hex-1-ene;(7S,8R,9S,10R,13S,14S,17R)-7-hexyl-10,13-dimethylspiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione.
| Compound Name | hex-1-ene;(7S,8R,9S,10R,13S,14S,17R)-7-hexyl-10,13-dimethylspiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 159876220 |
| Molecular Formula | C34H54O3 |
| Molecular Weight | 510.80 g/mol |
| Exact Mass | 510.41 |
| IUPAC Name | hex-1-ene;(7S,8R,9S,10R,13S,14S,17R)-7-hexyl-10,13-dimethylspiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
| SMILES | C=CCCCC.CCCCCC[C@H]1CC2=CC(=O)CC[C@]2(C)[C@H]2CC[C@@]3(C)[C@@H](CC[C@@]34CCC(=O)O4)[C@H]12 |
| InChI | InChI=1S/C28H42O3.C6H12/c1-4-5-6-7-8-19-17-20-18-21(29)9-13-26(20,2)22-10-14-27(3)23(25(19)22)11-15-28(27)16-12-24(30)31-28;1-3-5-6-4-2/h18-19,22-23,25H,4-17H2,1-3H3;3H,1,4-6H2,2H3/t19-,22-,23-,25+,26-,27-,28+;/m0./s1 |
| InChIKey | NSYAKBMWXHYAOO-MWLIGSKWSA-N |
| XLogP | 9.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.80 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|