C30H47NO2 — CID 20743364
10-[(7R,8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13,17-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-yl]decanenitrile (PubChem CID 20743364) has the molecular formula C30H47NO2 and a molecular weight of 453.71 g/mol. Its IUPAC name is 10-[(7R,8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13,17-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-yl]decanenitrile.
| Compound Name | 10-[(7R,8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13,17-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-yl]decanenitrile |
|---|---|
| PubChem CID | 20743364 |
| Molecular Formula | C30H47NO2 |
| Molecular Weight | 453.71 g/mol |
| Exact Mass | 453.36 |
| IUPAC Name | 10-[(7R,8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13,17-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-yl]decanenitrile |
| SMILES | C[C@]12CCC(=O)C=C1C[C@@H](CCCCCCCCCC#N)[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(C)O |
| InChI | InChI=1S/C30H47NO2/c1-28-16-13-24(32)21-23(28)20-22(12-10-8-6-4-5-7-9-11-19-31)27-25(28)14-17-29(2)26(27)15-18-30(29,3)33/h21-22,25-27,33H,4-18,20H2,1-3H3/t22-,25+,26+,27-,28+,29+,30+/m1/s1 |
| InChIKey | GHRFWUQXEQHFPE-XWLSUPBLSA-N |
| XLogP | 7.53 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.71 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|