C22H28ClNO2 — CID 11516300
2-[(1R,4aS,4bR,5R,10aR,10bS,12aS)-2-chloro-1-hydroxy-5,12a-dimethyl-8-oxo-4a,4b,5,6,9,10,10a,10b,11,12-decahydro-4H-chrysen-1-yl]acetonitrile (PubChem CID 11516300) has the molecular formula C22H28ClNO2 and a molecular weight of 373.92 g/mol. Its IUPAC name is 2-[(1R,4aS,4bR,5R,10aR,10bS,12aS)-2-chloro-1-hydroxy-5,12a-dimethyl-8-oxo-4a,4b,5,6,9,10,10a,10b,11,12-decahydro-4H-chrysen-1-yl]acetonitrile.
| Compound Name | 2-[(1R,4aS,4bR,5R,10aR,10bS,12aS)-2-chloro-1-hydroxy-5,12a-dimethyl-8-oxo-4a,4b,5,6,9,10,10a,10b,11,12-decahydro-4H-chrysen-1-yl]acetonitrile |
|---|---|
| PubChem CID | 11516300 |
| Molecular Formula | C22H28ClNO2 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-[(1R,4aS,4bR,5R,10aR,10bS,12aS)-2-chloro-1-hydroxy-5,12a-dimethyl-8-oxo-4a,4b,5,6,9,10,10a,10b,11,12-decahydro-4H-chrysen-1-yl]acetonitrile |
| SMILES | C[C@@H]1CC2=CC(=O)CC[C@@H]2[C@H]2CC[C@@]3(C)[C@@H](CC=C(Cl)[C@@]3(O)CC#N)[C@@H]21 |
| InChI | InChI=1S/C22H28ClNO2/c1-13-11-14-12-15(25)3-4-16(14)17-7-8-21(2)18(20(13)17)5-6-19(23)22(21,26)9-10-24/h6,12-13,16-18,20,26H,3-5,7-9,11H2,1-2H3/t13-,16+,17-,18+,20-,21+,22+/m1/s1 |
| InChIKey | YPXTYCSKHFMXAX-MHMFLHJCSA-N |
| XLogP | 4.75 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |