C21H26INO2 — CID 11190132
(7R,8R,9S,10R,13S,14S,17R)-17-hydroxy-17-[(E)-2-(125I)iodoethenyl]-13-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7-carbonitrile (PubChem CID 11190132) has the molecular formula C21H26INO2 and a molecular weight of 449.35 g/mol. Its IUPAC name is (7R,8R,9S,10R,13S,14S,17R)-17-hydroxy-17-[(E)-2-(125I)iodoethenyl]-13-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7-carbonitrile.
| Compound Name | (7R,8R,9S,10R,13S,14S,17R)-17-hydroxy-17-[(E)-2-(125I)iodoethenyl]-13-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7-carbonitrile |
|---|---|
| PubChem CID | 11190132 |
| Molecular Formula | C21H26INO2 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | (7R,8R,9S,10R,13S,14S,17R)-17-hydroxy-17-[(E)-2-(125I)iodoethenyl]-13-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7-carbonitrile |
| SMILES | C[C@]12CC[C@H]3[C@@H]([C@H](C#N)CC4=CC(=O)CC[C@@H]43)[C@@H]1CC[C@@]2(O)/C=C/[125I] |
| InChI | InChI=1S/C21H26INO2/c1-20-6-4-17-16-3-2-15(24)11-13(16)10-14(12-23)19(17)18(20)5-7-21(20,25)8-9-22/h8-9,11,14,16-19,25H,2-7,10H2,1H3/b9-8+/t14-,16-,17+,18-,19+,20-,21+/m0/s1/i22-2 |
| InChIKey | XTVOBGGWKRBOIS-NHUCUCRMSA-N |
| XLogP | 4.56 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|