C24H31NO — CID 90979259
(7S,8R,9S,10R,13S,14S,17S)-7-cyclopropyl-13,17-dimethyl-16-methylidene-3-oxo-2,6,7,8,9,10,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 90979259) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is (7S,8R,9S,10R,13S,14S,17S)-7-cyclopropyl-13,17-dimethyl-16-methylidene-3-oxo-2,6,7,8,9,10,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (7S,8R,9S,10R,13S,14S,17S)-7-cyclopropyl-13,17-dimethyl-16-methylidene-3-oxo-2,6,7,8,9,10,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 90979259 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | (7S,8R,9S,10R,13S,14S,17S)-7-cyclopropyl-13,17-dimethyl-16-methylidene-3-oxo-2,6,7,8,9,10,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | C=C1C[C@H]2[C@H]3[C@H](CC[C@]2(C)[C@@]1(C)C#N)[C@H]1CCC(=O)C=C1C[C@H]3C1CC1 |
| InChI | InChI=1S/C24H31NO/c1-14-10-21-22-19(8-9-23(21,2)24(14,3)13-25)18-7-6-17(26)11-16(18)12-20(22)15-4-5-15/h11,15,18-22H,1,4-10,12H2,2-3H3/t18-,19+,20-,21-,22-,23-,24-/m0/s1 |
| InChIKey | USWJNNHZSLENAP-IWMXCVPLSA-N |
| XLogP | 5.46 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|