C23H31NO — CID 25125975
(1R,2S,3R,5S,6S,7S,10S,11R,18R)-18-ethyl-6,7-dimethyl-14-oxopentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene-6-carbonitrile (PubChem CID 25125975) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is (1R,2S,3R,5S,6S,7S,10S,11R,18R)-18-ethyl-6,7-dimethyl-14-oxopentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene-6-carbonitrile.
| Compound Name | (1R,2S,3R,5S,6S,7S,10S,11R,18R)-18-ethyl-6,7-dimethyl-14-oxopentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene-6-carbonitrile |
|---|---|
| PubChem CID | 25125975 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (1R,2S,3R,5S,6S,7S,10S,11R,18R)-18-ethyl-6,7-dimethyl-14-oxopentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene-6-carbonitrile |
| SMILES | CC[C@@H]1CC2=CC(=O)CC[C@@H]2[C@H]2CC[C@@]3(C)[C@@H]([C@@H]4C[C@@H]4[C@]3(C)C#N)[C@H]12 |
| InChI | InChI=1S/C23H31NO/c1-4-13-9-14-10-15(25)5-6-16(14)17-7-8-22(2)21(20(13)17)18-11-19(18)23(22,3)12-24/h10,13,16-21H,4-9,11H2,1-3H3/t13-,16+,17-,18-,19+,20-,21+,22+,23+/m1/s1 |
| InChIKey | GLDZFORDJLHXQE-FCPFGRRHSA-N |
| XLogP | 5.15 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |