C23H33NO — CID 68914388
(7S,8R,9S,10R,13S,14S,17S)-7,13-diethyl-17-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 68914388) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is (7S,8R,9S,10R,13S,14S,17S)-7,13-diethyl-17-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (7S,8R,9S,10R,13S,14S,17S)-7,13-diethyl-17-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 68914388 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | (7S,8R,9S,10R,13S,14S,17S)-7,13-diethyl-17-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | CC[C@H]1CC2=CC(=O)CC[C@@H]2[C@H]2CC[C@@]3(CC)[C@@H](CC[C@]3(C)C#N)[C@H]12 |
| InChI | InChI=1S/C23H33NO/c1-4-15-12-16-13-17(25)6-7-18(16)19-8-11-23(5-2)20(21(15)19)9-10-22(23,3)14-24/h13,15,18-21H,4-12H2,1-3H3/t15-,18-,19+,20-,21+,22+,23-/m0/s1 |
| InChIKey | CACAHAQIYCGHGL-MVEJSWDWSA-N |
| XLogP | 5.68 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |