C24H40O2 — CID 70992294
(7S)-8,9-diethyl-7-(4-methoxybutyl)-7-methyl-3,4,4a,4b,5,6,8,8a,9,10-decahydrophenanthren-2-one (PubChem CID 70992294) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is (7S)-8,9-diethyl-7-(4-methoxybutyl)-7-methyl-3,4,4a,4b,5,6,8,8a,9,10-decahydrophenanthren-2-one.
| Compound Name | (7S)-8,9-diethyl-7-(4-methoxybutyl)-7-methyl-3,4,4a,4b,5,6,8,8a,9,10-decahydrophenanthren-2-one |
|---|---|
| PubChem CID | 70992294 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | (7S)-8,9-diethyl-7-(4-methoxybutyl)-7-methyl-3,4,4a,4b,5,6,8,8a,9,10-decahydrophenanthren-2-one |
| SMILES | CCC1CC2=CC(=O)CCC2C2CC[C@](C)(CCCCOC)C(CC)C12 |
| InChI | InChI=1S/C24H40O2/c1-5-17-15-18-16-19(25)9-10-20(18)21-11-13-24(3,12-7-8-14-26-4)22(6-2)23(17)21/h16-17,20-23H,5-15H2,1-4H3/t17?,20?,21?,22?,23?,24-/m0/s1 |
| InChIKey | RFCMUAQJWHAGBC-SCKVFJCOSA-N |
| XLogP | 6.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|