C24H34O3 — CID 143827952
[(13S,17S)-7-ethyl-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl propanoate (PubChem CID 143827952) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is [(13S,17S)-7-ethyl-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl propanoate.
| Compound Name | [(13S,17S)-7-ethyl-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl propanoate |
|---|---|
| PubChem CID | 143827952 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | [(13S,17S)-7-ethyl-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl propanoate |
| SMILES | CCC(=O)OC[C@H]1C=CC2C3C(CC)CC4=CC(=O)CCC4C3CC[C@@]21C |
| InChI | InChI=1S/C24H34O3/c1-4-15-12-16-13-18(25)7-8-19(16)20-10-11-24(3)17(14-27-22(26)5-2)6-9-21(24)23(15)20/h6,9,13,15,17,19-21,23H,4-5,7-8,10-12,14H2,1-3H3/t15?,17-,19?,20?,21?,23?,24-/m1/s1 |
| InChIKey | VEIXMCOCJYICEE-SODZROFBSA-N |
| XLogP | 5.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|