C32H50O5 — CID 70467182
[2-[[(8R,9S,10R,13S,14S,16S,17S)-16-ethyl-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-2-oxoethyl] decanoate (PubChem CID 70467182) has the molecular formula C32H50O5 and a molecular weight of 514.75 g/mol. Its IUPAC name is [2-[[(8R,9S,10R,13S,14S,16S,17S)-16-ethyl-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-2-oxoethyl] decanoate.
| Compound Name | [2-[[(8R,9S,10R,13S,14S,16S,17S)-16-ethyl-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-2-oxoethyl] decanoate |
|---|---|
| PubChem CID | 70467182 |
| Molecular Formula | C32H50O5 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | [2-[[(8R,9S,10R,13S,14S,16S,17S)-16-ethyl-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-2-oxoethyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OCC(=O)O[C@H]1[C@@H](CC)C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C32H50O5/c1-4-6-7-8-9-10-11-12-29(34)36-21-30(35)37-31-22(5-2)20-28-27-15-13-23-19-24(33)14-16-25(23)26(27)17-18-32(28,31)3/h19,22,25-28,31H,4-18,20-21H2,1-3H3/t22-,25-,26+,27+,28-,31-,32-/m0/s1 |
| InChIKey | RDEMDYYRIFGYJZ-OEJCNMHDSA-N |
| XLogP | 7.36 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|