C29H42O5 — CID 18604261
[1-[[(8S,13S,14S,16S,17S)-16-ethyl-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-1-oxopropan-2-yl] hexanoate (PubChem CID 18604261) has the molecular formula C29H42O5 and a molecular weight of 470.65 g/mol. Its IUPAC name is [1-[[(8S,13S,14S,16S,17S)-16-ethyl-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-1-oxopropan-2-yl] hexanoate.
| Compound Name | [1-[[(8S,13S,14S,16S,17S)-16-ethyl-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-1-oxopropan-2-yl] hexanoate |
|---|---|
| PubChem CID | 18604261 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | [1-[[(8S,13S,14S,16S,17S)-16-ethyl-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-1-oxopropan-2-yl] hexanoate |
| SMILES | CCCCCC(=O)OC(C)C(=O)O[C@H]1[C@@H](CC)C[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3CC[C@@]21C |
| InChI | InChI=1S/C29H42O5/c1-5-7-8-9-26(31)33-18(3)28(32)34-27-19(6-2)17-25-24-12-10-20-16-21(30)11-13-22(20)23(24)14-15-29(25,27)4/h16,18-19,24-25,27H,5-15,17H2,1-4H3/t18?,19-,24+,25-,27-,29-/m0/s1 |
| InChIKey | SQYMAXWRAHYWIU-YRFQHKNTSA-N |
| XLogP | 6.25 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|