C20H30O2 — CID 22791532
(7S,8S,8aS)-8-ethyl-7-(1-hydroxypropyl)-7-methyl-3,4,5,6,8,8a,9,10-octahydrophenanthren-2-one (PubChem CID 22791532) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (7S,8S,8aS)-8-ethyl-7-(1-hydroxypropyl)-7-methyl-3,4,5,6,8,8a,9,10-octahydrophenanthren-2-one.
| Compound Name | (7S,8S,8aS)-8-ethyl-7-(1-hydroxypropyl)-7-methyl-3,4,5,6,8,8a,9,10-octahydrophenanthren-2-one |
|---|---|
| PubChem CID | 22791532 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (7S,8S,8aS)-8-ethyl-7-(1-hydroxypropyl)-7-methyl-3,4,5,6,8,8a,9,10-octahydrophenanthren-2-one |
| SMILES | CCC(O)[C@@]1(C)CCC2=C3CCC(=O)C=C3CC[C@H]2[C@@H]1CC |
| InChI | InChI=1S/C20H30O2/c1-4-18-17-8-6-13-12-14(21)7-9-15(13)16(17)10-11-20(18,3)19(22)5-2/h12,17-19,22H,4-11H2,1-3H3/t17-,18+,19?,20+/m1/s1 |
| InChIKey | MBULLDWNAOVHKC-FBUBALKHSA-N |
| XLogP | 4.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |