C18H24O2 — CID 70261450
(8S,13R,14S)-13-(hydroxymethyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 70261450) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (8S,13R,14S)-13-(hydroxymethyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,13R,14S)-13-(hydroxymethyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70261450 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (8S,13R,14S)-13-(hydroxymethyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | O=C1C=C2CC[C@@H]3C(=C2CC1)CC[C@]1(CO)CCC[C@@H]31 |
| InChI | InChI=1S/C18H24O2/c19-11-18-8-1-2-17(18)16-5-3-12-10-13(20)4-6-14(12)15(16)7-9-18/h10,16-17,19H,1-9,11H2/t16-,17+,18+/m1/s1 |
| InChIKey | DTWWTEBCZZNSQG-SQNIBIBYSA-N |
| XLogP | 3.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |