C21H26O2 — CID 141079815
(8S,13R,14S)-13-(hydroxymethyl)-17-prop-1-ynyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 141079815) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (8S,13R,14S)-13-(hydroxymethyl)-17-prop-1-ynyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,13R,14S)-13-(hydroxymethyl)-17-prop-1-ynyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 141079815 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (8S,13R,14S)-13-(hydroxymethyl)-17-prop-1-ynyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC#CC1CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3CC[C@]12CO |
| InChI | InChI=1S/C21H26O2/c1-2-3-15-5-9-20-19-7-4-14-12-16(23)6-8-17(14)18(19)10-11-21(15,20)13-22/h12,15,19-20,22H,4-11,13H2,1H3/t15?,19-,20+,21+/m1/s1 |
| InChIKey | LDFOACQPUXMYKP-GDSUCZIISA-N |
| XLogP | 3.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|