C24H34O2 — CID 163932142
(5'S)-2'-(hydroxymethyl)-5',13-dimethylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,1'-cyclopentane]-3-one (PubChem CID 163932142) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is (5'S)-2'-(hydroxymethyl)-5',13-dimethylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,1'-cyclopentane]-3-one.
| Compound Name | (5'S)-2'-(hydroxymethyl)-5',13-dimethylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,1'-cyclopentane]-3-one |
|---|---|
| PubChem CID | 163932142 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (5'S)-2'-(hydroxymethyl)-5',13-dimethylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,1'-cyclopentane]-3-one |
| SMILES | C[C@H]1CCC(CO)C12CCC1C3CCC4=CC(=O)CCC4=C3CCC12C |
| InChI | InChI=1S/C24H34O2/c1-15-3-5-17(14-25)24(15)12-10-22-21-7-4-16-13-18(26)6-8-19(16)20(21)9-11-23(22,24)2/h13,15,17,21-22,25H,3-12,14H2,1-2H3/t15-,17?,21?,22?,23?,24?/m0/s1 |
| InChIKey | RJOSRMNLLCNGDW-DJASUKJOSA-N |
| XLogP | 5.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |