C25H33NO3 — CID 67645340
[(13S,17R)-17-(cyanomethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] 3-methylbutanoate (PubChem CID 67645340) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is [(13S,17R)-17-(cyanomethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] 3-methylbutanoate.
| Compound Name | [(13S,17R)-17-(cyanomethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 67645340 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | [(13S,17R)-17-(cyanomethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)O[C@@]1(CC#N)CCC2C3CCC4=CC(=O)CCC4=C3CC[C@@]21C |
| InChI | InChI=1S/C25H33NO3/c1-16(2)14-23(28)29-25(12-13-26)11-9-22-21-6-4-17-15-18(27)5-7-19(17)20(21)8-10-24(22,25)3/h15-16,21-22H,4-12,14H2,1-3H3/t21?,22?,24-,25+/m0/s1 |
| InChIKey | HWYDLSPUAPPIGR-UIIQDGRDSA-N |
| XLogP | 5.43 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |