C20H25NO2 — CID 154146948
3-[(8S,13R,14S)-17-hydroxy-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-13-yl]propanenitrile (PubChem CID 154146948) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 3-[(8S,13R,14S)-17-hydroxy-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-13-yl]propanenitrile.
| Compound Name | 3-[(8S,13R,14S)-17-hydroxy-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-13-yl]propanenitrile |
|---|---|
| PubChem CID | 154146948 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 3-[(8S,13R,14S)-17-hydroxy-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-13-yl]propanenitrile |
| SMILES | N#CCC[C@]12CCC3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CCC2O |
| InChI | InChI=1S/C20H25NO2/c21-11-1-9-20-10-8-16-15-5-3-14(22)12-13(15)2-4-17(16)18(20)6-7-19(20)23/h12,17-19,23H,1-10H2/t17-,18+,19?,20+/m1/s1 |
| InChIKey | JLXUWWWHDLFKCM-FBUBALKHSA-N |
| XLogP | 3.84 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |