C22H26O — CID 59976978
(13S)-17-but-1-ynyl-13-methyl-2,6,7,8,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 59976978) has the molecular formula C22H26O and a molecular weight of 306.45 g/mol. Its IUPAC name is (13S)-17-but-1-ynyl-13-methyl-2,6,7,8,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (13S)-17-but-1-ynyl-13-methyl-2,6,7,8,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 59976978 |
| Molecular Formula | C22H26O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (13S)-17-but-1-ynyl-13-methyl-2,6,7,8,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCC#CC1=CCC2C3CCC4=CC(=O)CCC4=C3CC[C@]12C |
| InChI | InChI=1S/C22H26O/c1-3-4-5-16-7-11-21-20-9-6-15-14-17(23)8-10-18(15)19(20)12-13-22(16,21)2/h7,14,20-21H,3,6,8-13H2,1-2H3/t20?,21?,22-/m1/s1 |
| InChIKey | FEZNYSFCBMFCIO-LZBANZJXSA-N |
| XLogP | 5.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|